
CAS 1217-08-9
:2,3-Dihydro-β,1,1,2,3,3-hexamethyl-1H-indene-5-ethanol
Description:
2,3-Dihydro-β,1,1,2,3,3-hexamethyl-1H-indene-5-ethanol, with CAS number 1217-08-9, is a chemical compound that belongs to the class of indene derivatives. This substance features a complex structure characterized by a bicyclic indene framework, which is further substituted with multiple methyl groups and a hydroxyl (alcohol) functional group. The presence of these substituents contributes to its unique physical and chemical properties, including its potential solubility in organic solvents and its reactivity in various chemical reactions. Typically, compounds of this nature may exhibit interesting biological activities, making them of interest in fields such as medicinal chemistry and fragrance formulation. Additionally, the steric hindrance introduced by the hexamethyl groups can influence the compound's stability and interaction with other molecules. Overall, 2,3-Dihydro-β,1,1,2,3,3-hexamethyl-1H-indene-5-ethanol is a notable compound for its structural complexity and potential applications in various chemical industries.
Formula:C17H26O
InChI:InChI=1S/C17H26O/c1-11(10-18)13-7-8-14-15(9-13)17(5,6)12(2)16(14,3)4/h7-9,11-12,18H,10H2,1-6H3
InChI key:InChIKey=FADUOCSCUWPALK-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(C(C)(C)C1C)=CC=C(C(CO)C)C2
Synonyms:- 2-(1,1,2,3,3-Pentamethylindan-5-yl)-1-propanol
- 2,3-Dihydro-β,1,1,2,3,3-hexamethyl-1H-indene-5-ethanol
- 1H-Indene-5-ethanol, 2,3-dihydro-β,1,1,2,3,3-hexamethyl-
- 5-Indanethanol, β,1,1,2,3,3-hexamethyl-
- 2-(1′,1′,2′,3′,3′-Pentamethylindan-5′-yl)propanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Indene-5-ethanol, 2,3-dihydro-β,1,1,2,3,3-hexamethyl-
CAS:Formula:C17H26OMolecular weight:246.3877
