CAS 1217-37-4: 1-(5-oxido-10H-phenothiazin-10-yl)ethanone

Description: 1-(5-oxido-10H-phenothiazin-10-yl)ethanone, with the CAS number 1217-37-4, is a chemical compound that belongs to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound features a phenothiazine core with an oxo group and an ethanone substituent, contributing to its unique reactivity and properties. It is typically recognized for its potential biological activity, often studied for its applications in pharmaceuticals, particularly in the development of antipsychotic and antidepressant medications. The presence of the oxo group enhances its reactivity, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit various physical properties such as solubility in organic solvents and specific melting or boiling points, which are influenced by its molecular structure. As with many phenothiazine derivatives, it may also display fluorescence, making it of interest in analytical chemistry and material science. Safety and handling precautions are essential due to potential toxicity associated with phenothiazine derivatives.

Formula: C₁₄H₁₁NO₂S

InChI: InChI=1/C14H11NO2S/c1-10(16)15-11-6-2-4-8-13(11)18(17)14-9-5-3-7-12(14)15/h2-9H,1H3

Synonyms:

• 10H-Phenothiazine, 10-acetyl-, 5-oxide
• ethanone, 1-(5-oxido-10H-phenothiazin-10-yl)-
• Phenothiazine, 10-acetyl-, 5-oxide

Ethanone, 1-(5-oxido-10H-phenothiazin-10-yl)-

CAS: 1217-37-4

• Formula: C₁₄H₁₁NO₂S
• Molecular weight: 257.3076

Promethazine Impurity 2

CAS: 1217-37-4

• Formula: C₁₄H₁₁NO₂S
• Molecular weight: 257.31