CymitQuimica logo

CAS 1217-49-8

:

methyl phenanthrene-9-carboxylate

Description:
Methyl phenanthrene-9-carboxylate, with the CAS number 1217-49-8, is an organic compound characterized by its structure, which includes a phenanthrene backbone and a carboxylate functional group esterified with a methyl group. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of the phenanthrene moiety. It is generally insoluble in water but soluble in organic solvents such as ethanol and acetone. Methyl phenanthrene-9-carboxylate may be utilized in various chemical applications, including organic synthesis and as an intermediate in the production of more complex molecules. Its reactivity is influenced by the functional groups present, allowing for potential reactions such as esterification and hydrolysis. Additionally, compounds of this nature can be studied for their biological activities and potential applications in pharmaceuticals or materials science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C16H12O2
InChI:InChI=1/C16H12O2/c1-18-16(17)15-10-11-6-2-3-7-12(11)13-8-4-5-9-14(13)15/h2-10H,1H3
SMILES:COC(=O)c1cc2ccccc2c2ccccc12
Synonyms:
  • Methyl 9-phenanthrenecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.