CymitQuimica logo

CAS 1217-84-1

:

5,5-Diphenyl-2,4-pentadienal

Description:
5,5-Diphenyl-2,4-pentadienal, with the CAS number 1217-84-1, is an organic compound characterized by its conjugated diene structure, which features two phenyl groups attached to a pentadienal backbone. This compound exhibits notable reactivity due to the presence of the aldehyde functional group, making it susceptible to nucleophilic attacks. Its conjugated system contributes to its potential applications in organic synthesis and materials science, as it can participate in various chemical reactions, including Diels-Alder reactions and other cycloaddition processes. The compound is typically a yellow to orange solid, and its physical properties, such as melting point and solubility, can vary based on purity and environmental conditions. Additionally, 5,5-Diphenyl-2,4-pentadienal may exhibit interesting optical properties due to its conjugated structure, which can be leveraged in the development of dyes or sensors. As with many organic compounds, proper handling and safety precautions are essential, as it may pose health risks if inhaled or ingested.
Formula:C17H14O
InChI:InChI=1S/C17H14O/c18-14-8-7-13-17(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H
InChI key:InChIKey=SVDKSXIMNXVDFQ-UHFFFAOYSA-N
SMILES:C(=CC=CC=O)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:
  • 2,4-Pentadienal, 5,5-diphenyl-
  • 5,5-Diphenyl-2,4-pentadienal
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.