
CAS 1217002-93-1
:Description:
The chemical substance with the CAS number 1217002-93-1 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of properties, including molecular weight, solubility, boiling and melting points, and reactivity, which are determined by their molecular structure and functional groups. To understand its characteristics, one would typically look at its physical properties, such as color and state at room temperature, as well as its chemical behavior, including stability under various conditions and potential applications in fields like pharmaceuticals, materials science, or industrial chemistry. For precise information, including safety data and handling instructions, consulting specialized chemical databases or literature is recommended.
Formula:C13H13N3·C2H4O2
InChI:InChI=1S/C13H13N3.C2H4O2/c1-7-12-11(8(2)15-13(7)14)9-5-3-4-6-10(9)16-12;1-2(3)4/h3-6,16H,1-2H3,(H2,14,15);1H3,(H,3,4)/i1+1,13+1,14+1;
InChI key:InChIKey=UXNRBAJNAWIPGF-PBLHTNPHSA-N
SMILES:CC1=C2C(NC=3C2=CC=CC3)=C([13CH3])[13C]([15NH2])=N1.C(C)(O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Amino-1,4-dimethyl-5H-pyrido[4,3-b]indole-13C2,15N Acetate
CAS:Controlled ProductFormula:C1313C2H17N215NO2Color and Shape:NeatMolecular weight:274.29
