CAS 121704-77-6
:1-(3-propoxyphenyl)ethanone
Description:
1-(3-Propoxyphenyl)ethanone, with the CAS number 121704-77-6, is an organic compound characterized by its ketone functional group and an aromatic ring. It features a propoxy group attached to the phenyl ring, which influences its solubility and reactivity. The presence of the ethanone moiety indicates that it has a carbonyl group (C=O) adjacent to an ethyl group, contributing to its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is likely to exhibit moderate volatility and may have a distinct odor. In terms of reactivity, 1-(3-propoxyphenyl)ethanone can participate in various chemical reactions typical of ketones, such as nucleophilic addition and oxidation. Its structural features suggest potential applications in organic synthesis, pharmaceuticals, or as a flavoring agent, although specific applications would depend on further research and development. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H14O2
InChI:InChI=1/C11H14O2/c1-3-7-13-11-6-4-5-10(8-11)9(2)12/h4-6,8H,3,7H2,1-2H3
SMILES:CCCOc1cccc(c1)C(=O)C
Synonyms:- Ethanone, 1-(3-Propoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
