CAS 121714-20-3

2,7-Dichloro-3,6-bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]-9H-xanthen-9-one

Description:

2,7-Dichloro-3,6-bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]-9H-xanthen-9-one, with CAS number 121714-20-3, is a synthetic organic compound characterized by its complex structure, which includes a xanthenone core substituted with chlorine and silyl ether groups. This compound typically exhibits properties such as high stability due to the presence of silyl groups, which can enhance its resistance to hydrolysis and degradation. The dichloro substitutions contribute to its potential reactivity and influence its electronic properties, making it useful in various applications, including as a dye or in photochemical processes. Its solubility may vary depending on the solvent, but it is generally more soluble in organic solvents than in water. Additionally, the presence of bulky tert-butyl groups can affect its steric hindrance and overall molecular interactions. Overall, this compound is of interest in fields such as materials science and organic synthesis due to its unique structural features and potential functional applications.

Formula: C₂₅H₃₄Cl₂O₄Si₂

InChI: InChI=1S/C25H34Cl2O4Si2/c1-24(2,3)32(7,8)30-21-13-19-15(11-17(21)26)23(28)16-12-18(27)22(14-20(16)29-19)31-33(9,10)25(4,5)6/h11-14H,1-10H3

InChI key: InChIKey=UVWQZXWKLVBKAO-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC=3C1=CC(Cl)=C(O[Si](C(C)(C)C)(C)C)C3)=CC(O[Si](C(C)(C)C)(C)C)=C(Cl)C2

Synonyms:

• 9H-Xanthen-9-one, 2,7-dichloro-3,6-bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]-
• 2,7-Dichloro-3,6-bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]-9H-xanthen-9-one