CAS 121716-19-6

Methyl 5-amino-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate

Description:

Methyl 5-amino-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of an amino group at the 5-position and a 4-fluorophenyl substituent at the 1-position enhances its potential for biological activity, making it of interest in medicinal chemistry. The fluorine atom in the phenyl ring can influence the compound's electronic properties and lipophilicity, potentially affecting its pharmacokinetics and interactions with biological targets. Methyl 5-amino-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate may exhibit various chemical behaviors, including hydrogen bonding and nucleophilic reactivity, due to its functional groups. Its CAS number, 121716-19-6, allows for precise identification in chemical databases, facilitating research and development in fields such as drug discovery and agrochemicals. Overall, this compound's unique structure and functional groups make it a subject of interest for further study.

Formula: C₁₁H₁₀FN₃O₂

InChI: InChI=1S/C11H10FN3O2/c1-17-11(16)9-6-14-15(10(9)13)8-4-2-7(12)3-5-8/h2-6H,13H2,1H3

InChI key: InChIKey=HCFPSWPMBRSTOS-UHFFFAOYSA-N

SMILES: NC=1N(N=CC1C(OC)=O)C2=CC=C(F)C=C2

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 5-amino-1-(4-fluorophenyl)-, methyl ester
• Methyl 5-amino-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate

methyl 5-amino-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylate

CAS: 121716-19-6

Formula: C₁₁H₁₀FN₃O₂

Purity: 95.0%

Molecular weight: 235.218

Ref: 10-F524972