
CAS 121716-27-6
:Ethyl 5-amino-3-methyl-1-phenyl-1H-pyrazole-4-carboxylate
Description:
Ethyl 5-amino-3-methyl-1-phenyl-1H-pyrazole-4-carboxylate, with the CAS number 121716-27-6, is a chemical compound that belongs to the class of pyrazole derivatives. This substance features a pyrazole ring, which is a five-membered ring containing two nitrogen atoms, and is substituted with an ethyl ester group and an amino group, contributing to its potential biological activity. The presence of the phenyl group enhances its lipophilicity, which may influence its interaction with biological targets. The compound is typically characterized by its solid state at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in research related to drug discovery and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C13H15N3O2
InChI:InChI=1S/C13H15N3O2/c1-3-18-13(17)11-9(2)15-16(12(11)14)10-7-5-4-6-8-10/h4-8H,3,14H2,1-2H3
InChI key:InChIKey=UHGWASXMFNXBBA-UHFFFAOYSA-N
SMILES:NC=1N(N=C(C)C1C(OCC)=O)C2=CC=CC=C2
Synonyms:- 5-Amino-3-methyl-1-phenyl-1H-pyrazole-4-carboxylic acid ethyl ester
- 1H-Pyrazole-4-carboxylic acid, 5-amino-3-methyl-1-phenyl-, ethyl ester
- Ethyl 5-amino-3-methyl-1-phenyl-1H-pyrazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrazole-4-carboxylic acid, 5-amino-3-methyl-1-phenyl-, ethyl ester
CAS:Formula:C13H15N3O2Molecular weight:245.2771
