CAS 1217269-85-6: Nonacyclo[28.2.2.22,5.26,9.210,13.214,17.218,21.222,25.226,29]octatetraconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35,37,39,41,43,45,47-tetracosaene
Description:Nonacyclo[28.2.2.22,5.26,9.210,13.214,17.218,21.222,25.226,29]octatetraconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35,37,39,41,43,45,47-tetracosaene is a complex polycyclic compound characterized by its extensive network of interconnected rings and multiple double bonds. This structure contributes to its unique electronic properties, making it of interest in materials science and organic electronics. The compound exhibits significant stability due to its rigid framework, which can influence its reactivity and interaction with light. Its large number of carbon atoms and the arrangement of double bonds may also impart interesting optical properties, potentially making it useful in applications such as organic photovoltaics or light-emitting devices. Additionally, the intricate structure may pose challenges in synthesis and characterization, requiring advanced techniques for analysis. Overall, this compound exemplifies the fascinating diversity of organic chemistry and the potential for novel applications in technology and materials.
Formula:C48H32
InChI:InChI=1S/C48H32/c1-2-34-4-3-33(1)35-5-7-37(8-6-35)39-13-15-41(16-14-39)43-21-23-45(24-22-43)47-29-31-48(32-30-47)46-27-25-44(26-28-46)42-19-17-40(18-20-42)38-11-9-36(34)10-12-38/h1-32H
InChI key:InChIKey=KOSJMHFAWQDZFH-UHFFFAOYSA-N
SMILES:C1=CC2=CC=C1C=3C=CC(=CC3)C=4C=CC(=CC4)C=5C=CC(=CC5)C=6C=CC(=CC6)C=7C=CC(=CC7)C=8C=CC(=CC8)C=9C=CC2=CC9
- Synonyms:
- Nonacyclo[28.2.2.22,5.26,9.210,13.214,17.218,21.222,25.226,29]octatetraconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35,37,39,41,43,45,47-tetracosaene
- Nonacyclo[28.2.2.22,5.26,9.210,13.214,17.218,21.222,25.226,29]octatetraconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,33,35,37,39,41,43,45,47-tetracosaene
- [8]Cycloparaphenylene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | [8]Cycloparaphenylene REF: 3B-C3544CAS: 1217269-85-6 | >95.0%(HPLC) | 504.00 € | Mon 10 Mar 25 |
![]() | [8]Cycloparaphenylene REF: IN-DA01E6K9CAS: 1217269-85-6 | 95% | 484.00 €~538.00 € | Mon 17 Mar 25 |
![]() | [8]Cycloparaphenylene REF: 3D-SYB26985CAS: 1217269-85-6 | Min. 95% | - - - | Discontinued product |

[8]Cycloparaphenylene
Ref: 3B-C3544
20mg | 504.00 € |

Ref: IN-DA01E6K9
10mg | 484.00 € |

[8]Cycloparaphenylene
Ref: 3D-SYB26985
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |