
CAS 1217272-33-7
:1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-acetonitrile
Description:
1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-acetonitrile is a chemical compound characterized by its unique bicyclic structure, which incorporates both a furan and an indene moiety. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the cyclic structure, contributing to its stability and reactivity. The acetonitrile functional group introduces a nitrile (-C≡N) moiety, which is known for its polar character and ability to participate in various chemical reactions, including nucleophilic additions and coordination with metal ions. The compound's molecular structure suggests potential applications in organic synthesis, pharmaceuticals, or materials science, particularly due to the presence of both aromatic and aliphatic characteristics. Its specific properties, such as solubility, melting point, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c14-7-5-10-2-1-9-3-4-12-11(13(9)10)6-8-15-12/h3-4,10H,1-2,5-6,8H2
InChI key:InChIKey=WPIVLYZNFICYFP-UHFFFAOYSA-N
SMILES:C(C#N)C1C=2C3=C(C=CC2CC1)OCC3
Synonyms:- 2-[1H,2H,6H,7H,8H-Indeno[5,4-b]furan-8-yl]acetonitrile
- 1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-acetonitrile
- 2H-Indeno[5,4-b]furan-8-acetonitrile, 1,6,7,8-tetrahydro-
- 1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-ylacetonitrile
- 2-(1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl)Acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
