CymitQuimica logo

CAS 121730-32-3

:

Nonatriacontanoic acid

Description:
Nonatriacontanoic acid, also known as nonatriacontanoic acid or C39H78O2, is a long-chain saturated fatty acid characterized by its long hydrocarbon chain consisting of 39 carbon atoms and a carboxylic acid functional group. This compound is typically found in various natural sources, including certain plant oils and animal fats. Nonatriacontanoic acid is a solid at room temperature, exhibiting high melting and boiling points due to its substantial molecular weight and the presence of strong van der Waals forces between the long hydrocarbon chains. It is insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature. This fatty acid is of interest in various fields, including biochemistry and materials science, due to its potential applications in the production of biodiesel, lubricants, and surfactants. Additionally, its structural properties may contribute to the study of lipid membranes and the development of novel materials with specific thermal and mechanical properties.
Formula:C39H78O2
InChI:InChI=1S/C39H78O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-32-33-34-35-36-37-38-39(40)41/h2-38H2,1H3,(H,40,41)
InChI key:InChIKey=SDUXWTQRQALDFW-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCCCCCCCCCCCC)CCCCCCCCCCC(O)=O
Synonyms:
  • Nonatriacontanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.