CAS 1217303-75-7

(5-Bromo-4-fluoro-2-nitrophenyl)hydrazine

Description:

(5-Bromo-4-fluoro-2-nitrophenyl)hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a substituted phenyl ring. The phenyl ring features three substituents: a bromine atom at the 5-position, a fluorine atom at the 4-position, and a nitro group at the 2-position, which contribute to its chemical reactivity and physical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential applications in medicinal chemistry and material science, particularly in the synthesis of more complex molecules. The presence of halogens and a nitro group can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature and potential toxicity.

Formula: C₆H₅BrFN₃O₂

InChI: InChI=1S/C6H5BrFN3O2/c7-3-1-5(10-9)6(11(12)13)2-4(3)8/h1-2,10H,9H2

InChI key: InChIKey=UECNBEKERZHWCF-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(NN)C=C(Br)C(F)=C1

Synonyms:

• Hydrazine, (5-bromo-4-fluoro-2-nitrophenyl)-
• (5-Bromo-4-fluoro-2-nitrophenyl)hydrazine