CAS 121733-80-0
:1-(Hydroxymethyl)propyl 2-propenoate
Description:
1-(Hydroxymethyl)propyl 2-propenoate, with the CAS number 121733-80-0, is an organic compound characterized by its functional groups, including a hydroxymethyl group and an acrylate moiety. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents, making it useful in various chemical applications. It possesses a reactive double bond characteristic of acrylates, which allows it to participate in polymerization reactions, making it valuable in the production of coatings, adhesives, and other polymeric materials. The presence of the hydroxymethyl group can enhance its reactivity and compatibility with other chemical entities. Additionally, this compound may exhibit properties such as low volatility and moderate viscosity, which can influence its handling and application in industrial processes. Safety considerations include potential irritant effects, necessitating appropriate handling measures. Overall, 1-(Hydroxymethyl)propyl 2-propenoate is a versatile compound with significant utility in the field of polymer chemistry.
Formula:C7H12O3
InChI:InChI=1S/C7H12O3/c1-3-6(5-8)10-7(9)4-2/h4,6,8H,2-3,5H2,1H3
InChI key:InChIKey=QQIFWCIRQPKKAH-UHFFFAOYSA-N
SMILES:C(OC(C=C)=O)(CC)CO
Synonyms:- 1-Hydroxybutan-2-yl prop-2-enoate
- 2-Propenoic acid, 1-(hydroxymethyl)propyl ester
- 1-(Hydroxymethyl)propyl 2-propenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
