CAS 1217439-06-9
:N-(4,5-Dihydro-1H-imidazol-2-yl)-5-methyl-6-quinolinamine
Description:
N-(4,5-Dihydro-1H-imidazol-2-yl)-5-methyl-6-quinolinamine is a chemical compound characterized by its unique structural features, which include a quinoline moiety and an imidazole ring. This compound typically exhibits properties associated with both heterocyclic amines and quinoline derivatives, such as potential biological activity and solubility in organic solvents. The presence of the imidazole ring may contribute to its ability to participate in hydrogen bonding and coordination with metal ions, which can be relevant in medicinal chemistry and drug design. Additionally, the methyl group at the 5-position of the quinoline ring may influence its lipophilicity and overall pharmacokinetic properties. The compound's specific interactions with biological targets can be explored further through in vitro and in vivo studies, making it of interest in the fields of pharmaceuticals and biochemistry. As with many heterocyclic compounds, its reactivity and stability can vary based on environmental conditions, such as pH and temperature.
Formula:C13H14N4
InChI:InChI=1S/C13H14N4/c1-9-10-3-2-6-14-12(10)5-4-11(9)17-13-15-7-8-16-13/h2-6H,7-8H2,1H3,(H2,15,16,17)
InChI key:InChIKey=FCRZSJQZPZTROM-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=CC1NC=3NCCN3)N=CC=C2
Synonyms:- N-(4,5-Dihydro-1H-imidazol-2-yl)-5-methyl-6-quinolinamine
- 6-Quinolinamine, N-(4,5-dihydro-1H-imidazol-2-yl)-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.

