CymitQuimica logo

CAS 1217456-32-0

:

(αR)-2-Chloro-5-fluoro-α-methylbenzenemethanamine

Description:
(αR)-2-Chloro-5-fluoro-α-methylbenzenemethanamine is a chemical compound characterized by its specific structural features, including a chloro and a fluoro substituent on a benzene ring, along with an amine functional group. The presence of the α-methyl group indicates that the compound has a chiral center, which contributes to its stereochemistry, denoted by the (αR) configuration. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The halogen substituents (chlorine and fluorine) can significantly affect the compound's electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions or influencing its interaction with biological targets. Given its structural complexity, this compound may have applications in medicinal chemistry or as an intermediate in the synthesis of more complex molecules. However, specific safety and handling guidelines should be followed due to the presence of halogenated groups, which can pose environmental and health risks.
Formula:C8H9ClFN
InChI:InChI=1S/C8H9ClFN/c1-5(11)7-4-6(10)2-3-8(7)9/h2-5H,11H2,1H3/t5-/m1/s1
InChI key:InChIKey=QCOOJFVYFYLDCA-RXMQYKEDSA-N
SMILES:[C@H](C)(N)C1=C(Cl)C=CC(F)=C1
Synonyms:
  • (αR)-2-Chloro-5-fluoro-α-methylbenzenemethanamine
  • Benzenemethanamine, 2-chloro-5-fluoro-α-methyl-, (αR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.