CymitQuimica logo

CAS 1217463-36-9

:

1-Piperazinecarboxylic acid, 2-butyl-, 1,1-dimethylethyl ester, hydrochloride (1:1), (2R)-

Description:
1-Piperazinecarboxylic acid, 2-butyl-, 1,1-dimethylethyl ester, hydrochloride (1:1), (2R)- is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a butyl group and a tert-butyl ester moiety, contributing to its hydrophobic characteristics. The hydrochloride form indicates that it is a salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The (2R)- designation suggests that it has a specific stereochemistry, which can influence its biological activity and interactions. Generally, compounds of this nature may exhibit properties such as being a potential intermediate in organic synthesis or having pharmacological relevance, depending on their functional groups and overall structure. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C13H26N2O2·ClH
InChI:InChI=1S/C13H26N2O2.ClH/c1-5-6-7-11-10-14-8-9-15(11)12(16)17-13(2,3)4;/h11,14H,5-10H2,1-4H3;1H/t11-;/m1./s1
InChI key:InChIKey=CUEVHLSHYHGZFJ-RFVHGSKJSA-N
SMILES:C(CCC)[C@H]1N(C(OC(C)(C)C)=O)CCNC1.Cl
Synonyms:
  • 1-Piperazinecarboxylic acid, 2-butyl-, 1,1-dimethylethyl ester, hydrochloride (1:1), (2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.