CAS 121747-90-8

Isochandalone

Description:

Isochandalone, with the CAS number 121747-90-8, is a chemical compound that belongs to the class of organic compounds known as ketones. It is characterized by its unique molecular structure, which includes a carbonyl group (C=O) flanked by hydrocarbon chains. This compound is typically recognized for its potential applications in various fields, including pharmaceuticals and organic synthesis. Isochandalone may exhibit specific physical properties such as a distinct boiling point and solubility characteristics, which can vary based on its molecular interactions. Additionally, it may possess functional groups that contribute to its reactivity and ability to participate in chemical reactions, making it a subject of interest in synthetic organic chemistry. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further research and characterization are often necessary to fully understand its properties and potential applications in various chemical processes.

Formula: C₂₅H₂₄O₅

InChI: InChI=1S/C25H24O5/c1-14(2)5-7-17-19(26)12-21-22(23(17)27)24(28)18(13-29-21)15-6-8-20-16(11-15)9-10-25(3,4)30-20/h5-6,8-13,26-27H,7H2,1-4H3

InChI key: InChIKey=CUDNUXBRPAPDBJ-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(O)=C(CC=C(C)C)C2O)OC=C1C=3C=C4C(=CC3)OC(C)(C)C=C4

Synonyms:

• 3-(2,2-Dimethyl-2H-1-benzopyran-6-yl)-5,7-dihydroxy-6-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 3-(2,2-dimethyl-2H-1-benzopyran-6-yl)-5,7-dihydroxy-6-(3-methyl-2-butenyl)-
• 4H-1-Benzopyran-4-one,3-(2,2-dimethyl-2H-1-benzopyran-6-yl)-5,7-dihydroxy-6-(3-methyl-2-butenyl)-(9CI)
• Isochandalone
• 4H-1-Benzopyran-4-one, 3-(2,2-dimethyl-2H-1-benzopyran-6-yl)-5,7-dihydroxy-6-(3-methyl-2-buten-1-yl)-
• 3-(2,2-Dimethyl-2H-1-benzopyran-6-yl)-5,7-dihydroxy-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one
• 5,7-Dihydroxy-6-(3-methyl-2-butenyl)-3-(2,2-dimethyl-2H-1-benzopyran-6-yl)-4H-1-benzopyran-4-one

4H-1-Benzopyran-4-one, 3-(2,2-dimethyl-2H-1-benzopyran-6-yl)-5,7-dihydroxy-6-(3-methyl-2-buten-1-yl)-

CAS: 121747-90-8

Formula: C₂₅H₂₄O₅

Purity: 98.0%

Molecular weight: 404.4551

Ref: IN-DA0015QM

Isochandalone

CAS: 121747-90-8

Isochandalone is a natural product from Derris robusta.

Formula: C₂₅H₂₄O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 404.46

Ref: TM-TN4272

Isochandalone

CAS: 121747-90-8

Formula: C₂₅H₂₄O₅

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 404.462

Ref: BP-SBP02570

Isochandalone

CAS: 121747-90-8

Isochandalone is a synthetic chemical compound, which is derived from a series of complex organic synthesis processes involving precursor molecules found in certain natural derivatives. Its mode of action involves the inhibition of specific enzymatic pathways that are essential for the proliferation and survival of malignant cells; it also modulates inflammatory pathways by interacting with key signaling molecules involved in the immune response.

Formula: C₂₅H₂₄O₅

Purity: Min. 95%

Molecular weight: 404.5 g/mol

Ref: 3D-WEA74790