CymitQuimica logo

CAS 1217471-97-0

:

(S)-1-Benzyl 3-methyl piperazine-1,3-dicarboxylate hydrochloride

Description:
(S)-1-Benzyl 3-methyl piperazine-1,3-dicarboxylate hydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a benzyl group and a methyl group, contributing to its unique properties and potential biological activity. The presence of two carboxylate groups indicates that it can participate in various chemical reactions, including esterification and amidation. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The stereochemistry indicated by the "(S)" designation suggests that it has specific spatial arrangements that can influence its interaction with biological targets, making it of interest in medicinal chemistry. Overall, this compound's structural features suggest potential applications in drug development, particularly in areas requiring selective binding to biological receptors or enzymes. However, specific biological activities and pharmacological profiles would require further investigation through experimental studies.
Formula:C14H19ClN2O4
InChI:InChI=1S/C14H18N2O4.ClH/c1-19-13(17)12-9-16(8-7-15-12)14(18)20-10-11-5-3-2-4-6-11;/h2-6,12,15H,7-10H2,1H3;1H/t12-;/m0./s1
InChI key:KBTDRWBNFLCGPG-YDALLXLXSA-N
SMILES:COC(=O)[C@@H]1CN(CCN1)C(=O)OCC2=CC=CC=C2.Cl
Found 2 products.