CAS 121748-11-6: threo-Syringylglycerol

Description:Threo-Syringylglycerol is a phenolic compound characterized by its structural features, which include a glycerol backbone and syringyl moieties. It is a dihydroxyphenyl compound, specifically derived from syringol, and is known for its potential antioxidant properties. This compound is often studied in the context of plant biochemistry and may play a role in the defense mechanisms of certain plants. Threo-Syringylglycerol is soluble in organic solvents and exhibits varying degrees of solubility in water, depending on the conditions. Its chemical behavior is influenced by the presence of hydroxyl groups, which can participate in hydrogen bonding and contribute to its reactivity. Additionally, it may have implications in the field of pharmacology and nutrition due to its bioactive properties. Research into threo-Syringylglycerol continues to explore its potential applications in health and wellness, particularly in relation to its antioxidant capacity and effects on cellular processes.

Formula:C₁₁H₁₆O₆

InChI:InChI=1/C11H16O6/c1-16-8-3-6(10(14)7(13)5-12)4-9(17-2)11(8)15/h3-4,7,10,12-15H,5H2,1-2H3/t7-,10-/s2

InChI key:InChIKey=GIZSHQYTTBQKOQ-ONRUVPORNA-N

SMILES:OC1=C(OC)C=C(C=C1OC)C(O)C(O)CO

Synonyms:
1,2,3-Propanetriol,1-(4-hydroxy-3,5-dimethoxyphenyl)-, (R*,R*)-
rel-(1R,2R)-1-(4-Hydroxy-3,5-dimethoxyphenyl)-1,2,3-propanetriol
threo-1-C-Syringylglycerol
threo-Syringylglycerol
1,2,3-Propanetriol, 1-(4-hydroxy-3,5-dimethoxyphenyl)-, (1R,2R)-rel-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
threo-1-C-Syringylglycerol REF: TM-TN5143CAS: 121748-11-6	98%	593.00 €	Thu 10 Apr 25
threo-1-C-Syringylglycerol REF: BP-SBP00738CAS: 121748-11-6	95%~99%	To inquire	Mon 14 Apr 25
threo-1-C-Syringylglycerol REF: 3D-FT42580CAS: 121748-11-6	Min. 95%	- - -	Discontinued product