CAS 1217486-79-7
:6-Bromo-1-(1,1-dimethylethyl)-2-ethoxy-2,3-dihydro-2-methyl-1H-benzimidazole
Description:
6-Bromo-1-(1,1-dimethylethyl)-2-ethoxy-2,3-dihydro-2-methyl-1H-benzimidazole is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with a bromine atom and an ethoxy group. The presence of the bulky tert-butyl group (1,1-dimethylethyl) contributes to its steric properties, potentially influencing its reactivity and interactions with biological targets. This compound may exhibit specific pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential lipophilicity due to the ethoxy and tert-butyl groups, which could affect its solubility and permeability in biological systems. The bromine substituent may also play a role in the compound's electronic properties, potentially enhancing its reactivity in certain chemical reactions. Overall, the unique combination of functional groups and structural features makes this compound a candidate for further investigation in various chemical and pharmaceutical applications.
Formula:C14H21BrN2O
InChI:InChI=1S/C14H21BrN2O/c1-6-18-14(5)16-11-8-7-10(15)9-12(11)17(14)13(2,3)4/h7-9,16H,6H2,1-5H3
InChI key:InChIKey=MAFRHHOYEOYANK-UHFFFAOYSA-N
SMILES:O(CC)C1(C)N(C(C)(C)C)C=2C(N1)=CC=C(Br)C2
Synonyms:- 1H-Benzimidazole, 6-bromo-1-(1,1-dimethylethyl)-2-ethoxy-2,3-dihydro-2-methyl-
- 6-Bromo-1-(1,1-dimethylethyl)-2-ethoxy-2,3-dihydro-2-methyl-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.