CymitQuimica logo

CAS 1217486-99-1

:

N-(4-Methyl-2-thiazolyl)-1H-imidazole-1-carboxamide

Description:
N-(4-Methyl-2-thiazolyl)-1H-imidazole-1-carboxamide, identified by its CAS number 1217486-99-1, is a chemical compound characterized by its unique structural features, which include an imidazole ring and a thiazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in pharmaceutical research. The presence of the thiazole and imidazole rings suggests that it may interact with biological targets, possibly influencing enzymatic or receptor activities. Its molecular structure allows for various functional group interactions, which can be crucial for its efficacy in biological systems. Additionally, the methyl group on the thiazole ring may enhance lipophilicity, affecting its pharmacokinetic properties. Overall, this compound's characteristics position it as a candidate for further investigation in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C8H8N4OS
InChI:InChI=1S/C8H8N4OS/c1-6-4-14-7(10-6)11-8(13)12-3-2-9-5-12/h2-5H,1H3,(H,10,11,13)
InChI key:InChIKey=XEZPZAPGTKDMFS-UHFFFAOYSA-N
SMILES:C(NC1=NC(C)=CS1)(=O)N2C=CN=C2
Synonyms:
  • N-(4-Methyl-2-thiazolyl)-1H-imidazole-1-carboxamide
  • 1H-Imidazole-1-carboxamide, N-(4-methyl-2-thiazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.