CAS 121749-67-5
:5-Bromo-1,1,1-trifluoro-2-pentanone
Description:
5-Bromo-1,1,1-trifluoro-2-pentanone is a halogenated ketone characterized by the presence of a bromine atom and three fluorine atoms attached to a five-carbon chain. This compound features a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of the bromine and trifluoromethyl groups significantly influences its physical and chemical properties, including increased lipophilicity and potential for electrophilic reactions. It is typically a colorless to pale yellow liquid at room temperature, with a distinctive odor. The trifluoromethyl group enhances its stability and makes it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this substance, as halogenated compounds can pose health risks and environmental concerns. Overall, 5-Bromo-1,1,1-trifluoro-2-pentanone is a valuable compound in the field of synthetic organic chemistry.
Formula:C5H6BrF3O
InChI:InChI=1S/C5H6BrF3O/c6-3-1-2-4(10)5(7,8)9/h1-3H2
InChI key:InChIKey=OHZNFMNKCSNUCK-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(CCCBr)=O
Synonyms:- 2-Pentanone, 5-bromo-1,1,1-trifluoro-
- 5-Bromo-1,1,1-trifluoro-2-pentanone
- 1,1,1-Trifluoro-5-bromo-2-pentanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.