
CAS 121749-84-6
:1-[(2-Hydroxyethoxy)methyl]-6-iodo-2,4(1H,3H)-pyrimidinedione
Description:
1-[(2-Hydroxyethoxy)methyl]-6-iodo-2,4(1H,3H)-pyrimidinedione, with CAS number 121749-84-6, is a chemical compound characterized by its pyrimidinedione core structure, which features a 6-iodo substituent and a 2-hydroxyethoxy methyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential solubility in polar solvents due to the presence of hydroxyl and ether functional groups. The iodine atom introduces unique reactivity, potentially influencing its biological activity and interactions. The presence of the pyrimidinedione moiety suggests that it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, which can affect its pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. As with many chemical substances, safety and handling precautions should be observed, given the potential hazards associated with iodine and other reactive groups present in its structure.
Formula:C7H9IN2O4
InChI:InChI=1S/C7H9IN2O4/c8-5-3-6(12)9-7(13)10(5)4-14-2-1-11/h3,11H,1-2,4H2,(H,9,12,13)
InChI key:InChIKey=QTJFTAKEXZDOEP-UHFFFAOYSA-N
SMILES:C(OCCO)N1C(I)=CC(=O)NC1=O
Synonyms:- 1-[(2-Hydroxyethoxy)methyl]-6-iodo-2,4(1H,3H)-pyrimidinedione
- 2,4(1H,3H)-Pyrimidinedione, 1-[(2-hydroxyethoxy)methyl]-6-iodo-
- 1-[(2-Hydroxyethoxy)methyl]-6-iodouracil
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4(1H,3H)-Pyrimidinedione, 1-[(2-hydroxyethoxy)methyl]-6-iodo-
CAS:Formula:C7H9IN2O4Molecular weight:312.0618
