CAS 121750-57-0

(E)-1-(4-Chlorophenoxycarbonyl)-1,2,5,6-tetrahydropyridine-3-carboxaldehyde O-methyloxime

Description:

(E)-1-(4-Chlorophenoxycarbonyl)-1,2,5,6-tetrahydropyridine-3-carboxaldehyde O-methyloxime, with CAS number 121750-57-0, is a chemical compound characterized by its complex structure, which includes a tetrahydropyridine ring, a chlorophenyl group, and an oxime functional group. This compound typically exhibits properties associated with both aldehydes and oximes, such as reactivity towards nucleophiles and potential for forming stable derivatives. The presence of the chlorophenyl moiety may impart specific electronic and steric effects, influencing its reactivity and interactions in chemical reactions. Additionally, the oxime group can participate in various chemical transformations, making it a versatile intermediate in organic synthesis. The compound's solubility, stability, and reactivity can vary depending on the solvent and conditions used. Overall, this substance may find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features and potential biological activity.

Formula: C₁₄H₁₅ClN₂O₃

InChI: InChI=1/C14H15ClN2O3/c1-19-16-9-11-3-2-8-17(10-11)14(18)20-13-6-4-12(15)5-7-13/h3-7,9H,2,8,10H2,1H3/b16-9+

Synonyms:

• Itameline
• (E)-3-[(Methoxyimino)methyl]-1,2,5,6-tetrahydropyridine-1-carboxylic acid 4-chlorophenyl ester
• 4-chlorophenyl 5-[(E)-(methoxyimino)methyl]-3,6-dihydropyridine-1(2H)-carboxylate
• RU-47213

(EZ)-Itameline

CAS: 121750-57-0

(EZ)-Itameline

Purity: ≥98%

Molecular weight: 294.73g/mol

Ref: 54-BUP03878

(EZ)-Itameline

CAS: 121750-57-0

Itameline (RU 47213) can be used as a choline mimetic.

Formula: C₁₄H₁₅ClN₂O₃

Purity: 99.9%

Color and Shape: Solid

Molecular weight: 294.73

Ref: TM-T68089