CAS 1217500-65-6

B-[2-Fluoro-5-(2-methylpropoxy)phenyl]boronic acid

Description:

B-[2-Fluoro-5-(2-methylpropoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a fluorine atom and a branched alkoxy group, which contributes to its unique chemical properties. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its reactivity, while the boronic acid moiety allows for participation in cross-coupling reactions, such as Suzuki-Miyaura coupling. This compound may also exhibit interesting biological activities due to its structural characteristics. Its solubility and stability in different solvents can vary, which is important for its application in synthetic pathways. Overall, B-[2-Fluoro-5-(2-methylpropoxy)phenyl]boronic acid is a versatile compound with potential uses in pharmaceuticals and materials science.

Formula: C₁₀H₁₄BFO₃

InChI: InChI=1S/C10H14BFO3/c1-7(2)6-15-8-3-4-10(12)9(5-8)11(13)14/h3-5,7,13-14H,6H2,1-2H3

InChI key: InChIKey=OYEDQMGDFFCTRX-UHFFFAOYSA-N

SMILES: O(CC(C)C)C1=CC(B(O)O)=C(F)C=C1

Synonyms:

• Boronic acid, B-[2-fluoro-5-(2-methylpropoxy)phenyl]-
• (2-Fluoro-5-isobutoxyphenyl)boronic acid
• B-[2-Fluoro-5-(2-methylpropoxy)phenyl]boronic acid
• [2-Fluoro-5-(2-methylpropoxy)phenyl]boronic acid

Boronic acid, B-[2-fluoro-5-(2-methylpropoxy)phenyl]-

CAS: 1217500-65-6

Formula: C₁₀H₁₄BFO₃

Purity: 95%

Molecular weight: 212.0258

Ref: IN-DA0015R7

2-Fluoro-5-isobutoxyphenylboronic acid

CAS: 1217500-65-6

2-Fluoro-5-isobutoxyphenylboronic acid

Purity: ≥95%

Molecular weight: 212.03g/mol

Ref: 54-PC412433

(2-Fluoro-5-isobutoxyphenyl)boronic acid

CAS: 1217500-65-6

Formula: C₁₀H₁₄BFO₃

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 212.03

Ref: 10-F228503