CAS 1217500-68-9

B-[2-Fluoro-5-(phenylmethoxy)phenyl]boronic acid

Description:

B-[2-Fluoro-5-(phenylmethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a fluorinated phenyl ring, which can enhance its electronic properties and influence its reactivity. The phenylmethoxy substituent contributes to its lipophilicity, potentially affecting its solubility and biological activity. Boronic acids are often utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, the presence of the fluorine atom may impart unique characteristics such as increased metabolic stability or altered binding affinity in biological systems. Overall, this compound's structural features suggest potential utility in drug development and materials science, particularly in the design of targeted therapies or advanced functional materials.

Formula: C₁₃H₁₂BFO₃

InChI: InChI=1S/C13H12BFO3/c15-13-7-6-11(8-12(13)14(16)17)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2

InChI key: InChIKey=DIHHJULQESBDHE-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=CC(B(O)O)=C(F)C=C2

Synonyms:

• B-[2-Fluoro-5-(phenylmethoxy)phenyl]boronic acid
• Boronic acid, B-[2-fluoro-5-(phenylmethoxy)phenyl]-

Boronic acid, B-[2-fluoro-5-(phenylmethoxy)phenyl]-

CAS: 1217500-68-9

Formula: C₁₃H₁₂BFO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 246.0420

Ref: IN-DA0015R4

5-(Benzyloxy)-2-fluorophenylboronic acid

CAS: 1217500-68-9

5-(Benzyloxy)-2-fluorophenylboronic acid

Purity: ≥95%

Molecular weight: 246.04g/mol

Ref: 54-PC412231

(5-(Benzyloxy)-2-fluorophenyl)boronic acid

CAS: 1217500-68-9

Formula: C₁₃H₁₂BFO₃

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 246.04

Ref: 10-F228504