CAS 1217500-72-5

B-[2-[(4-Methoxyphenyl)methoxy]-5-pyrimidinyl]boronic acid

Description:

B-[2-[(4-Methoxyphenyl)methoxy]-5-pyrimidinyl]boronic acid, identified by its CAS number 1217500-72-5, is a boronic acid derivative characterized by the presence of a boron atom bonded to a pyrimidine ring and a methoxyphenyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the methoxy group enhances its solubility and may influence its reactivity and biological activity. Additionally, the pyrimidine moiety can contribute to the compound's potential as a pharmacophore in drug development, particularly in targeting specific biological pathways. The compound's structural features suggest it may participate in hydrogen bonding and π-π stacking interactions, which are significant in biological systems. Overall, B-[2-[(4-Methoxyphenyl)methoxy]-5-pyrimidinyl]boronic acid is a versatile compound with potential applications in research and therapeutic contexts.

Formula: C₁₂H₁₃BN₂O₄

InChI: InChI=1S/C12H13BN2O4/c1-18-11-4-2-9(3-5-11)8-19-12-14-6-10(7-15-12)13(16)17/h2-7,16-17H,8H2,1H3

InChI key: InChIKey=DDOPLKCYKQDZCF-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(OC)C=C1)C=2N=CC(B(O)O)=CN2

Synonyms:

• Boronic acid, B-[2-[(4-methoxyphenyl)methoxy]-5-pyrimidinyl]-
• B-[2-[(4-Methoxyphenyl)methoxy]-5-pyrimidinyl]boronic acid

2-(4-Methoxybenzyloxy)pyrimidine-5-boronic acid

CAS: 1217500-72-5

Formula: C₁₂H₁₃BN₂O₄

Molecular weight: 260.0536

Ref: IN-DA0015R0

2-(4-Methoxybenzyloxy)pyrimidine-5-boronic acid

CAS: 1217500-72-5

2-(4-Methoxybenzyloxy)pyrimidine-5-boronic acid

Purity: ≥95%

Molecular weight: 260.05g/mol

Ref: 54-OR360434