CAS 1217500-96-3

B-[3-Fluoro-5-(1-pyrrolidinyl)phenyl]boronic acid

Description:

B-[3-Fluoro-5-(1-pyrrolidinyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a phenyl ring substituted with a fluorine atom and a pyrrolidine moiety, contributing to its unique chemical reactivity and potential applications in medicinal chemistry, particularly in drug development and synthesis. The fluorine substitution can enhance the compound's lipophilicity and metabolic stability, while the boronic acid group is often utilized in cross-coupling reactions, such as Suzuki-Miyaura coupling, making it valuable in the synthesis of complex organic molecules. Additionally, the presence of the pyrrolidine ring may influence the compound's biological activity and interaction with biological targets. Overall, B-[3-Fluoro-5-(1-pyrrolidinyl)phenyl]boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₁₀H₁₃BFNO₂

InChI: InChI=1S/C10H13BFNO2/c12-9-5-8(11(14)15)6-10(7-9)13-3-1-2-4-13/h5-7,14-15H,1-4H2

InChI key: InChIKey=WOSGIIGBIQODBX-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C=C(C=C(F)C1)N2CCCC2

Synonyms:

• Boronic acid, B-[3-fluoro-5-(1-pyrrolidinyl)phenyl]-
• B-[3-Fluoro-5-(1-pyrrolidinyl)phenyl]boronic acid

Boronic acid, B-[3-fluoro-5-(1-pyrrolidinyl)phenyl]-

CAS: 1217500-96-3

Formula: C₁₀H₁₃BFNO₂

Purity: 95%

Molecular weight: 209.0251

Ref: IN-DA0015RS

3-Fluoro-5-pyrrolidinophenylboronic acid

CAS: 1217500-96-3

3-Fluoro-5-pyrrolidinophenylboronic acid

Purity: ≥95%

Molecular weight: 209.03g/mol

Ref: 54-PC412158

(3-Fluoro-5-(pyrrolidin-1-yl)phenyl)boronic acid

CAS: 1217500-96-3

Formula: C₁₀H₁₃BFNO₂

Purity: ≥95%

Molecular weight: 209.03

Ref: 10-F216212