CAS 1217500-97-4

B-[4-[(2-Methylpropyl)thio]phenyl]boronic acid

Description:

B-[4-[(2-Methylpropyl)thio]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a thioether group. This compound typically exhibits properties such as being a white to off-white solid, soluble in organic solvents, and having moderate stability under ambient conditions. The boronic acid moiety allows for reversible interactions with diols, making it useful in various applications, including organic synthesis and as a reagent in Suzuki coupling reactions. The presence of the 2-methylpropylthio group enhances its solubility and may influence its reactivity and selectivity in chemical reactions. Additionally, compounds like this are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Overall, B-[4-[(2-Methylpropyl)thio]phenyl]boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₁₀H₁₅BO₂S

InChI: InChI=1S/C10H15BO2S/c1-8(2)7-14-10-5-3-9(4-6-10)11(12)13/h3-6,8,12-13H,7H2,1-2H3

InChI key: InChIKey=ROAGXTNYXGUULT-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC=C(SCC(C)C)C=C1

Synonyms:

• B-[4-[(2-Methylpropyl)thio]phenyl]boronic acid
• Boronic acid, B-[4-[(2-methylpropyl)thio]phenyl]-

Boronic acid, B-[4-[(2-methylpropyl)thio]phenyl]-

CAS: 1217500-97-4

Formula: C₁₀H₁₅BO₂S

Purity: 95%

Molecular weight: 210.1009

Ref: IN-DA0015RR

4-(Isobutylthio)phenylboronic acid

CAS: 1217500-97-4

4-(Isobutylthio)phenylboronic acid

Purity: ≥95%

Molecular weight: 210.10g/mol

Ref: 54-OR361291

(4-(Isobutylthio)phenyl)boronic acid

CAS: 1217500-97-4

Formula: C₁₀H₁₅BO₂S

Purity: ≥95%

Molecular weight: 210.1

Ref: 10-F224703