CymitQuimica logo

CAS 1217501-00-2

:

B-[4-(1-Cyanocyclopropyl)phenyl]boronic acid

Description:
B-[4-(1-Cyanocyclopropyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a cyanocyclopropyl group. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the cyano group enhances its reactivity and may influence its electronic properties, potentially making it a candidate for use in drug development or as a building block in organic synthesis. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in forming carbon-carbon bonds. The compound's solubility, stability, and reactivity can vary depending on the solvent and conditions used, and it may exhibit specific interactions with biological targets, making it of interest in pharmaceutical research. Overall, B-[4-(1-Cyanocyclopropyl)phenyl]boronic acid represents a versatile structure in the field of organic and medicinal chemistry.
Formula:C10H10BNO2
InChI:InChI=1S/C10H10BNO2/c12-7-10(5-6-10)8-1-3-9(4-2-8)11(13)14/h1-4,13-14H,5-6H2
InChI key:InChIKey=NOICYZKSQYFZPX-UHFFFAOYSA-N
SMILES:C(#N)C1(CC1)C2=CC=C(B(O)O)C=C2
Synonyms:
  • Boronic acid, B-[4-(1-cyanocyclopropyl)phenyl]-
  • 4-(1-Cyano-1-cyclopropyl)phenylboronic acid
  • (4-(1-Cyanocyclopropyl)phenyl)boronic acid
  • B-[4-(1-Cyanocyclopropyl)phenyl]boronic acid
Found 4 products.