CAS 1217501-13-7

B-[5-(1,1-Dimethylethyl)-2-ethoxyphenyl]boronic acid

Description:

B-[5-(1,1-Dimethylethyl)-2-ethoxyphenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a bulky tert-butyl group and an ethoxy group, which can influence its solubility and reactivity. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds. This compound may exhibit properties such as moderate stability under ambient conditions, but it can be sensitive to moisture due to the presence of the boronic acid group. Its unique structure may also impart specific biological activities, making it a candidate for further research in drug development or as a reagent in synthetic chemistry. Overall, B-[5-(1,1-Dimethylethyl)-2-ethoxyphenyl]boronic acid is a versatile compound with significant potential in various chemical applications.

Formula: C₁₂H₁₉BO₃

InChI: InChI=1S/C12H19BO3/c1-5-16-11-7-6-9(12(2,3)4)8-10(11)13(14)15/h6-8,14-15H,5H2,1-4H3

InChI key: InChIKey=AYLPSEIACDGNHG-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(OCC)C=CC(C(C)(C)C)=C1

Synonyms:

• B-[5-(1,1-Dimethylethyl)-2-ethoxyphenyl]boronic acid
• Boronic acid, B-[5-(1,1-dimethylethyl)-2-ethoxyphenyl]-

Boronic acid, B-[5-(1,1-dimethylethyl)-2-ethoxyphenyl]-

CAS: 1217501-13-7

Formula: C₁₂H₁₉BO₃

Purity: 95%

Molecular weight: 222.0885

Ref: IN-DA0015RC

5-tert-Butyl-2-ethoxyphenylboronic acid

CAS: 1217501-13-7

5-tert-Butyl-2-ethoxyphenylboronic acid

Purity: ≥95%

Molecular weight: 222.09g/mol

Ref: 54-OR361616

(5-(Tert-butyl)-2-ethoxyphenyl)boronic acid

CAS: 1217501-13-7

Purity: ≥95%

Molecular weight: 222.0899963

Ref: 10-F694273