CAS 1217501-15-9

B-[3,5-Dimethyl-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl]boronic acid

Description:

B-[3,5-Dimethyl-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl]boronic acid is a boronic acid derivative characterized by its unique structural features, including a pyrazole ring and a tetrahydro-pyran moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the dimethyl groups on the pyrazole ring can influence its reactivity and solubility, while the tetrahydro-pyran group may enhance its stability and bioavailability. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The compound's specific interactions and reactivity can be further explored in the context of drug development and material science, where its unique functional groups may provide advantageous properties for targeted applications. Overall, this compound represents a versatile building block in synthetic chemistry.

Formula: C₁₀H₁₇BN₂O₃

InChI: InChI=1S/C10H17BN2O3/c1-7-10(11(14)15)8(2)13(12-7)9-5-3-4-6-16-9/h9,14-15H,3-6H2,1-2H3

InChI key: InChIKey=YOFFBMDCMBAWSH-UHFFFAOYSA-N

SMILES: CC=1N(N=C(C)C1B(O)O)C2CCCCO2

Synonyms:

• B-[3,5-Dimethyl-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl]boronic acid
• Boronic acid, B-[3,5-dimethyl-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl]-

3,5-Dimethyl-1-(THP)pyrazole-4-boronic acid

CAS: 1217501-15-9

Formula: C₁₀H₁₇BN₂O₃

Molecular weight: 224.0646

Ref: IN-DA0015SN

3,5-Dimethyl-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazole-4-boronic acid

CAS: 1217501-15-9

3,5-Dimethyl-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazole-4-boronic acid

Purity: ≥95%

Molecular weight: 224.06g/mol

Ref: 54-OR361176