CAS 1217501-20-6

B-[1-(2,2-Diethoxyethyl)-1H-pyrazol-4-yl]boronic acid

Description:

B-[1-(2,2-Diethoxyethyl)-1H-pyrazol-4-yl]boronic acid is a boronic acid derivative characterized by its unique structure, which includes a pyrazole ring and a diethoxyethyl substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyrazole moiety may impart specific biological activities, potentially enhancing its utility in drug development. Additionally, the diethoxyethyl group can influence the solubility and stability of the compound in different solvents. Boronic acids are known for their role in Suzuki coupling reactions, which are essential for forming carbon-carbon bonds in organic synthesis. Overall, B-[1-(2,2-Diethoxyethyl)-1H-pyrazol-4-yl]boronic acid is a versatile compound with potential applications in both synthetic and pharmaceutical chemistry, owing to its reactivity and structural features.

Formula: C₉H₁₇BN₂O₄

InChI: InChI=1S/C9H17BN2O4/c1-3-15-9(16-4-2)7-12-6-8(5-11-12)10(13)14/h5-6,9,13-14H,3-4,7H2,1-2H3

InChI key: InChIKey=QXGDFMFEWNRPLV-UHFFFAOYSA-N

SMILES: C(C(OCC)OCC)N1C=C(B(O)O)C=N1

Synonyms:

• Boronic acid, B-[1-(2,2-diethoxyethyl)-1H-pyrazol-4-yl]-
• B-[1-(2,2-Diethoxyethyl)-1H-pyrazol-4-yl]boronic acid

Boronic acid, B-[1-(2,2-diethoxyethyl)-1H-pyrazol-4-yl]-

CAS: 1217501-20-6

Formula: C₉H₁₇BN₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 228.0533

Ref: IN-DA0015SJ

1-(2,2-Diethoxyethyl)pyrazole-4-boronic acid

CAS: 1217501-20-6

1-(2,2-Diethoxyethyl)pyrazole-4-boronic acid

Purity: 98%

Molecular weight: 228.05g/mol

Ref: 54-OR361119

1-(2,2-Diethoxyethyl)pyrazole-4-boronic acid

CAS: 1217501-20-6

Purity: 98%

Molecular weight: 228.0599976

Ref: 10-F623729