CAS 1217501-30-8: B-[2-(Triethylsilyl)benzo[b]thien-7-yl]boronic acid

Description:B-[2-(Triethylsilyl)benzo[b]thien-7-yl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it valuable in various organic synthesis applications, particularly in Suzuki coupling reactions. The compound features a triethylsilyl group, which enhances its stability and solubility in organic solvents, while the benzo[b]thienyl moiety contributes to its aromatic character and potential electronic properties. The presence of the boronic acid group allows for participation in cross-coupling reactions, making it a useful intermediate in the synthesis of complex organic molecules. Additionally, the compound may exhibit unique physical and chemical properties due to the steric and electronic effects of the triethylsilyl group, influencing its reactivity and interactions with other chemical species. Overall, this compound is significant in the field of organic chemistry, particularly in the development of new materials and pharmaceuticals.

Formula:C₁₄H₂₁BO₂SSi

InChI:InChI=1S/C14H21BO2SSi/c1-4-19(5-2,6-3)13-10-11-8-7-9-12(15(16)17)14(11)18-13/h7-10,16-17H,4-6H2,1-3H3

InChI key:InChIKey=ATBZXNSUWPJLEO-UHFFFAOYSA-N

SMILES:OB(O)C1=CC=CC=2C=C(SC21)[Si](CC)(CC)CC

Synonyms:
B-[2-(Triethylsilyl)benzo[b]thien-7-yl]boronic acid
Boronic acid, B-[2-(triethylsilyl)benzo[b]thien-7-yl]-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Boronic acid, B-[2-(triethylsilyl)benzo[b]thien-7-yl]- REF: IN-DA0015SACAS: 1217501-30-8	- - -	To inquire	Mon 03 Mar 25
2-(Triethylsilyl)benzothiophene-7-boronic acid REF: 54-OR360467CAS: 1217501-30-8	- - -	To inquire	Tue 04 Mar 25
(2-(Triethylsilyl)benzo[b]thiophen-7-yl)boronic acid REF: 10-F692498CAS: 1217501-30-8	95%	- - -	Discontinued product
2-(Triethylsilyl)benzothiophene-7-boronic acid REF: 3D-SYB50130CAS: 1217501-30-8	Min. 95%	- - -	Discontinued product