
CAS 1217501-40-0
:B-[3-Methoxy-2-(methoxymethoxy)phenyl]boronic acid
Description:
B-[3-Methoxy-2-(methoxymethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with methoxy groups. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible complexes with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The methoxy substituents enhance its solubility in organic solvents and may influence its reactivity and selectivity in chemical reactions. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. The presence of multiple methoxy groups can also affect the electronic properties of the molecule, potentially impacting its reactivity and interaction with biological targets. Overall, B-[3-Methoxy-2-(methoxymethoxy)phenyl]boronic acid is a versatile compound with significant utility in synthetic organic chemistry and pharmaceutical development.
Formula:C9H13BO5
InChI:InChI=1S/C9H13BO5/c1-13-6-15-9-7(10(11)12)4-3-5-8(9)14-2/h3-5,11-12H,6H2,1-2H3
InChI key:InChIKey=VXQIYKOLPANYBF-UHFFFAOYSA-N
SMILES:O(COC)C1=C(B(O)O)C=CC=C1OC
Synonyms:- Boronic acid, B-[3-methoxy-2-(methoxymethoxy)phenyl]-
- [3-Methoxy-2-(methoxymethoxy)phenyl]boronic acid
- B-[3-Methoxy-2-(methoxymethoxy)phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
