CAS 1217501-41-1

B-[5-Chloro-2-(1-methylethoxy)-3-pyridinyl]boronic acid

Description:

B-[5-Chloro-2-(1-methylethoxy)-3-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyridine ring substituted with a chlorine atom and an ethoxy group, contributing to its unique chemical reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis. Additionally, the presence of the chlorine and ethoxy substituents can influence the compound's solubility, stability, and interaction with biological targets. Overall, this compound exemplifies the versatility of boronic acids in synthetic chemistry and their role in drug discovery and development.

Formula: C₈H₁₁BClNO₃

InChI: InChI=1S/C8H11BClNO3/c1-5(2)14-8-7(9(12)13)3-6(10)4-11-8/h3-5,12-13H,1-2H3

InChI key: InChIKey=NMVYPCNDMPTZQR-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=C(B(O)O)C=C(Cl)C=N1

Synonyms:

• Boronic acid, B-[5-chloro-2-(1-methylethoxy)-3-pyridinyl]-
• B-[5-Chloro-2-(1-methylethoxy)-3-pyridinyl]boronic acid

Boronic acid, B-[5-chloro-2-(1-methylethoxy)-3-pyridinyl]-

CAS: 1217501-41-1

Formula: C₈H₁₁BClNO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 215.4418

Ref: IN-DA0015T9

5-Chloro-2-isopropoxypyridine-3-boronic acid

CAS: 1217501-41-1

5-Chloro-2-isopropoxypyridine-3-boronic acid

Purity: ≥95%

Molecular weight: 215.44g/mol

Ref: 54-OR360508

(5-Chloro-2-isopropoxypyridin-3-yl)boronic acid

CAS: 1217501-41-1

Formula: C₈H₁₁BClNO₃

Purity: 96%

Molecular weight: 215.44

Ref: 10-F228520