CAS 1217501-47-7

B-[2-Methyl-4-[(propylamino)sulfonyl]phenyl]boronic acid

Description:

B-[2-Methyl-4-[(propylamino)sulfonyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a methyl group and a propylamino sulfonyl group, contributing to its unique chemical properties. The presence of the boronic acid moiety allows it to participate in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis and medicinal chemistry. Additionally, the sulfonamide group may enhance its solubility and biological activity. The compound's structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Its CAS number, 1217501-47-7, provides a unique identifier for regulatory and research purposes. Overall, this compound exemplifies the versatility of boronic acids in synthetic chemistry and their importance in developing new therapeutic agents.

Formula: C₁₀H₁₆BNO₄S

InChI: InChI=1S/C10H16BNO4S/c1-3-6-12-17(15,16)9-4-5-10(11(13)14)8(2)7-9/h4-5,7,12-14H,3,6H2,1-2H3

InChI key: InChIKey=QDJSKXQJUINZIX-UHFFFAOYSA-N

SMILES: S(NCCC)(=O)(=O)C1=CC(C)=C(B(O)O)C=C1

Synonyms:

• B-[2-Methyl-4-[(propylamino)sulfonyl]phenyl]boronic acid
• Boronic acid, B-[2-methyl-4-[(propylamino)sulfonyl]phenyl]-

2-Methyl-4-(N-propylsulfamoyl)phenylboronic acid

CAS: 1217501-47-7

Formula: C₁₀H₁₆BNO₄S

Molecular weight: 257.1143

Ref: IN-DA0015T3

2-Methyl-4-(N-propylsulfamoyl)phenylboronic acid

CAS: 1217501-47-7

2-Methyl-4-(N-propylsulfamoyl)phenylboronic acid

Purity: ≥95%

Molecular weight: 257.11g/mol

Ref: 54-OR360385