CAS 121751-67-5

1-[(4-methoxyphenyl)sulfonyl]piperazine

Description:

1-[(4-methoxyphenyl)sulfonyl]piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The compound features a sulfonyl group attached to a 4-methoxyphenyl moiety, contributing to its unique properties. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its sulfonyl group can participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, which can be exploited in synthetic applications. Additionally, the structural features of 1-[(4-methoxyphenyl)sulfonyl]piperazine may allow for interactions with biological targets, suggesting potential therapeutic uses. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound should be evaluated in the context of its intended use.

Formula: C₁₁H₁₆N₂O₃S

InChI: InChI=1/C11H16N2O3S/c1-16-10-2-4-11(5-3-10)17(14,15)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3

SMILES: COc1ccc(cc1)S(=O)(=O)N1CCNCC1

Synonyms:

• Piperazine, 1-[(4-methoxyphenyl)sulfonyl]-
• 1-[(4-Methoxyphenyl)sulfonyl]piperazine

1-[(4-Methoxyphenyl)sulfonyl]piperazine, HCl

CAS: 121751-67-5

Formula: C₁₁H₁₆N₂O₃S

Molecular weight: 256.3213

Ref: IN-DA0015TD

1-((4-Methoxyphenyl)sulfonyl)piperazine

CAS: 121751-67-5

1-((4-Methoxyphenyl)sulfonyl)piperazine

Purity: 95%

Molecular weight: 256.33g/mol

Ref: 54-OR1053503

1-(4-Methoxy-benzenesulfonyl)-piperazine

CAS: 121751-67-5

Formula: C₁₁H₁₆N₂O₃S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 256.32

Ref: 10-F019988