
CAS 1217602-18-0
:rel-(2R,4R)-4-Butyl-D-glutamic acid
Description:
Rel-(2R,4R)-4-Butyl-D-glutamic acid is a chiral amino acid derivative characterized by its specific stereochemistry, which is indicated by the (2R,4R) configuration. This compound features a butyl group attached to the fourth carbon of the glutamic acid backbone, influencing its solubility and biological activity. As a glutamic acid derivative, it retains the carboxylic acid functional groups typical of amino acids, contributing to its potential as a neurotransmitter or metabolic intermediate. The presence of the butyl group may enhance lipophilicity, affecting its interaction with biological membranes and receptors. This compound is of interest in various fields, including pharmaceuticals and biochemistry, due to its potential roles in metabolic pathways and as a building block for peptide synthesis. Its specific CAS number, 1217602-18-0, allows for precise identification in chemical databases and literature. Overall, rel-(2R,4R)-4-Butyl-D-glutamic acid exemplifies the complexity and diversity of amino acid derivatives in chemical and biological systems.
Formula:C9H17NO4
InChI:InChI=1/C9H17NO4/c1-2-3-4-6(8(11)12)5-7(10)9(13)14/h6-7H,2-5,10H2,1H3,(H,11,12)(H,13,14)/t6-,7-/s2
InChI key:InChIKey=IMGQZBSGZRAKSV-WZTWBHKBNA-N
SMILES:[C@H](C[C@H](C(O)=O)N)(CCCC)C(O)=O
Synonyms:- rel-(2R,4R)-4-Butyl-D-glutamic acid
- D-Glutamic acid, 4-butyl-, (2R,4R)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.