
CAS 1217603-27-4
:rel-(αR,βR)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-3-fluoro-α-hydroxybenzenepropanoic acid
Description:
The chemical substance known as rel-(αR,βR)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-3-fluoro-α-hydroxybenzenepropanoic acid, with the CAS number 1217603-27-4, is a synthetic compound that features a complex structure characterized by a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is commonly used in peptide synthesis. This compound contains a fluorine atom, which can influence its reactivity and biological activity. The presence of an α-hydroxy group suggests potential for hydrogen bonding and interactions with biological targets. The stereochemistry indicated by the rel-(αR,βR) designation implies specific spatial arrangements of atoms, which can significantly affect the compound's pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could enhance binding affinity or selectivity for certain biological receptors. Overall, its characteristics suggest potential applications in drug design and development, although further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C24H20FNO5
InChI:InChI=1/C24H20FNO5/c25-15-7-5-6-14(12-15)21(22(27)23(28)29)26-24(30)31-13-20-18-10-3-1-8-16(18)17-9-2-4-11-19(17)20/h1-12,20-22,27H,13H2,(H,26,30)(H,28,29)/t21-,22-/s2
InChI key:InChIKey=FSXQXXAESIAQAK-XHEJRLEYNA-N
SMILES:C(OC(N[C@H]([C@@H](C(O)=O)O)C1=CC(F)=CC=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- rel-(αR,βR)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-3-fluoro-α-hydroxybenzenepropanoic acid
- Benzenepropanoic acid, β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-3-fluoro-α-hydroxy-, (αR,βR)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(2S,3S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-fluorophenyl)-2-hydroxypropanoic acid
CAS:Formula:C24H20FNO5Molecular weight:421.4177
