CAS 1217606-19-3

rel-(R,4R)-4-(3-Fluorophenoxy)-D-proline methyl ester

Description:

Rel-(R,4R)-4-(3-Fluorophenoxy)-D-proline methyl ester is a chemical compound characterized by its specific stereochemistry and functional groups. It features a proline backbone, which is an amino acid known for its cyclic structure and role in protein synthesis. The presence of a fluorophenoxy group indicates that it has a fluorine atom substituted on a phenyl ring, which can influence its biological activity and lipophilicity. The methyl ester functionality suggests that the compound is likely to be more soluble in organic solvents and may exhibit different reactivity compared to its carboxylic acid counterpart. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its stereochemical configuration (R,4R) is crucial for its biological activity, as chirality can significantly affect the pharmacodynamics and pharmacokinetics of a drug. Overall, this compound's unique structure and properties make it a subject of interest in various chemical and biological research fields.

Formula: C₁₂H₁₄FNO₃

InChI: InChI=1/C12H14FNO3/c1-16-12(15)11-6-10(7-14-11)17-9-4-2-3-8(13)5-9/h2-5,10-11,14H,6-7H2,1H3/t10-,11-/s2

InChI key: InChIKey=BFZJTRBZXQIPDE-DUJBIPCPNA-N

SMILES: O([C@H]1C[C@@H](C(OC)=O)NC1)C2=CC(F)=CC=C2

Synonyms:

• D-Proline, 4-(3-fluorophenoxy)-, methyl ester, (R,4R)-rel-
• rel-(R,4R)-4-(3-Fluorophenoxy)-D-proline methyl ester