CAS 1217610-35-9
:N-[(1,1-Dimethylethoxy)carbonyl]-N-methyl-1-(triphenylmethyl)-L-histidine
Description:
N-[(1,1-Dimethylethoxy)carbonyl]-N-methyl-1-(triphenylmethyl)-L-histidine is a synthetic compound that belongs to the class of amino acid derivatives. It features a histidine backbone, which is an essential amino acid known for its role in protein synthesis and various metabolic processes. The presence of the triphenylmethyl group contributes to its lipophilicity and may enhance its stability and solubility in organic solvents. The dimethylethoxycarbonyl moiety serves as a protective group, which can be useful in synthetic applications, particularly in peptide synthesis. This compound may exhibit interesting biological activities due to its structural features, making it a potential candidate for research in medicinal chemistry. Its CAS number, 1217610-35-9, allows for easy identification in chemical databases. Overall, this compound's unique structure and functional groups suggest potential applications in drug development and biochemical research, although specific biological activities and properties would require further investigation.
Formula:C31H33N3O4
InChI:InChI=1S/C31H33N3O4/c1-30(2,3)38-29(37)33(4)27(28(35)36)20-26-21-34(22-32-26)31(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,21-22,27H,20H2,1-4H3,(H,35,36)/t27-/m0/s1
InChI key:InChIKey=SWXYPSNTJGPVOJ-MHZLTWQESA-N
SMILES:C(N1C=C(C[C@H](N(C(OC(C)(C)C)=O)C)C(O)=O)N=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- L-Histidine, N-[(1,1-dimethylethoxy)carbonyl]-N-methyl-1-(triphenylmethyl)-
- (2S)-2-[Methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(1-tritylimidazol-4-yl)propanoic acid
- N-[(1,1-Dimethylethoxy)carbonyl]-N-methyl-1-(triphenylmethyl)-L-histidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.