CAS 1217628-30-2
:rel-(2R)-2-(Aminomethyl)-3-methyl-1-[(2R)-2-(phenylmethoxy)-1-pyrrolidinyl]-1-butanone
Description:
The chemical substance known as rel-(2R)-2-(Aminomethyl)-3-methyl-1-[(2R)-2-(phenylmethoxy)-1-pyrrolidinyl]-1-butanone, with the CAS number 1217628-30-2, is a synthetic compound that belongs to the class of substituted amines. It features a complex molecular structure characterized by a butanone backbone, which is substituted with an aminomethyl group and a pyrrolidine moiety. The presence of a phenylmethoxy group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its stereochemistry, indicated by the "rel" and "(2R)" designations, suggests that it may have specific interactions with biological targets, which could be relevant for therapeutic applications. As with many synthetic organic compounds, its solubility, stability, and reactivity would depend on environmental conditions and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential uses in various fields, including pharmaceuticals and biochemistry.
Formula:C17H26N2O2
InChI:InChI=1/C17H26N2O2/c1-13(2)15(11-18)17(20)19-10-6-9-16(19)21-12-14-7-4-3-5-8-14/h3-5,7-8,13,15-16H,6,9-12,18H2,1-2H3/t15-,16+/s2
InChI key:InChIKey=ZVCUUQOSXAHEEI-REIYMHPCNA-N
SMILES:C([C@H](C(C)C)CN)(=O)N1[C@H](OCC2=CC=CC=C2)CCC1
Synonyms:- 1-Butanone, 2-(aminomethyl)-3-methyl-1-[(2R)-2-(phenylmethoxy)-1-pyrrolidinyl]-, (2R)-rel-
- rel-(2R)-2-(Aminomethyl)-3-methyl-1-[(2R)-2-(phenylmethoxy)-1-pyrrolidinyl]-1-butanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.