CymitQuimica logo

CAS 1217630-38-0

:

(2S)-2-(2,5-DIFLUOROPHENYL)PYRROLIDINE

Description:
(2S)-2-(2,5-Difluorophenyl)pyrrolidine is a chemical compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The compound features a chiral center at the second carbon of the pyrrolidine, denoted by the (2S) configuration, indicating its specific stereochemistry. The presence of a 2,5-difluorophenyl group attached to the pyrrolidine enhances its potential for biological activity, as fluorine atoms can influence the compound's lipophilicity and metabolic stability. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in various therapeutic contexts. Additionally, the compound's unique characteristics, such as solubility and reactivity, are influenced by the functional groups present, making it a valuable candidate for further research in synthetic and medicinal chemistry.
Formula:C10H11F2N
InChI:InChI=1S/C10H11F2N/c11-7-3-4-9(12)8(6-7)10-2-1-5-13-10/h3-4,6,10,13H,1-2,5H2/t10-/m0/s1
InChI key:NCXSNNVYILYEBC-JTQLQIEISA-N
SMILES:C1C[C@H](NC1)C2=C(C=CC(=C2)F)F
Found 4 products.