
CAS 1217651-50-7
:rel-(4S)-4-[[(1,1-Dimethylethoxy)carbonyl]amino]-D-proline
Description:
Rel-(4S)-4-[[(1,1-Dimethylethoxy)carbonyl]amino]-D-proline is a synthetic amino acid derivative characterized by its unique structural features that include a proline backbone with a dimethylethoxycarbonyl group attached to the amino group. This compound is notable for its chirality, specifically the S configuration at the 4-position, which influences its biological activity and interactions. The presence of the dimethylethoxycarbonyl group enhances its stability and solubility, making it suitable for various applications in peptide synthesis and medicinal chemistry. The compound's structure allows for potential incorporation into peptides, which can be utilized in drug development and research. Additionally, the proline moiety contributes to the conformational flexibility of peptides, impacting their overall biological function. As with many amino acid derivatives, its properties can be influenced by factors such as pH and temperature, which are critical for its application in biochemical contexts. Overall, this compound represents a valuable building block in the field of organic and medicinal chemistry.
Formula:C10H18N2O4
InChI:InChI=1/C10H18N2O4/c1-10(2,3)16-9(15)12-6-4-7(8(13)14)11-5-6/h6-7,11H,4-5H2,1-3H3,(H,12,15)(H,13,14)/t6-,7+/s2
InChI key:InChIKey=ZLTYSXLMVYGBJO-JHPDDGAFNA-N
SMILES:N(C(OC(C)(C)C)=O)[C@H]1C[C@H](C(O)=O)NC1
Synonyms:- rel-(4S)-4-[[(1,1-Dimethylethoxy)carbonyl]amino]-D-proline
- D-Proline, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-, (4S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.