CAS 1217662-99-1

rel-(R,4R)-4-(2,4-Dichloro-3,5-dimethylphenoxy)-D-proline methyl ester

Description:

The chemical substance known as rel-(R,4R)-4-(2,4-Dichloro-3,5-dimethylphenoxy)-D-proline methyl ester, with the CAS number 1217662-99-1, is a synthetic compound that belongs to the class of proline derivatives. It features a proline backbone, which is an amino acid known for its role in protein structure and function. The presence of a dichlorophenyl group and methyl ester functionality contributes to its unique chemical properties, potentially influencing its solubility, reactivity, and biological activity. This compound may exhibit specific stereochemistry, indicated by the rel-(R,4R) designation, which can affect its interaction with biological targets, making it of interest in pharmaceutical research. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully understand its properties, including its stability, reactivity, and biological effects. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₄H₁₇Cl₂NO₃

InChI: InChI=1/C14H17Cl2NO3/c1-7-4-11(13(16)8(2)12(7)15)20-9-5-10(17-6-9)14(18)19-3/h4,9-10,17H,5-6H2,1-3H3/t9-,10-/s2

InChI key: InChIKey=ILLSBEGHCONTKT-WSYQHHSTNA-N

SMILES: O(C1=C(Cl)C(C)=C(Cl)C(C)=C1)[C@H]2C[C@@H](C(OC)=O)NC2

Synonyms:

• rel-(R,4R)-4-(2,4-Dichloro-3,5-dimethylphenoxy)-D-proline methyl ester
• D-Proline, 4-(2,4-dichloro-3,5-dimethylphenoxy)-, methyl ester, (R,4R)-rel-