CymitQuimica logo

CAS 121768-37-4

:

N-(1-Naphthyl)-1-adamantanecarboxamide

Description:
N-(1-Naphthyl)-1-adamantanecarboxamide, identified by its CAS number 121768-37-4, is a chemical compound characterized by its unique structure that combines an adamantane core with a naphthyl group. This compound typically exhibits properties associated with both its naphthyl and adamantane components, such as hydrophobicity and potential for forming strong intermolecular interactions. It is often studied for its biological activity, particularly in the context of medicinal chemistry, where it may exhibit properties relevant to drug design or as a pharmacological agent. The presence of the adamantane structure can contribute to increased stability and lipophilicity, while the naphthyl moiety may enhance interactions with biological targets. Additionally, this compound may display interesting thermal and solubility characteristics, making it a subject of interest in various chemical and pharmaceutical applications. Its synthesis and characterization are important for understanding its potential uses in research and industry.
Formula:C21H23NO
InChI:InChI=1S/C21H23NO/c23-20(21-11-14-8-15(12-21)10-16(9-14)13-21)22-19-7-3-5-17-4-1-2-6-18(17)19/h1-7,14-16H,8-13H2,(H,22,23)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.