CAS 121772-94-9
:6-Chloro-3-pyridinecarbonyl fluoride
Description:
6-Chloro-3-pyridinecarbonyl fluoride, with the CAS number 121772-94-9, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro substituent at the 6-position and a carbonyl fluoride group at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its ability to act as a reagent in various chemical reactions, particularly in the synthesis of more complex organic molecules. Due to the presence of the fluoride group, it may exhibit properties such as high reactivity and potential toxicity, necessitating careful handling and storage. As with many halogenated compounds, it may also have implications for environmental and health safety, making it essential to follow appropriate safety protocols when working with it.
Formula:C6H3ClFNO
InChI:InChI=1S/C6H3ClFNO/c7-5-2-1-4(3-9-5)6(8)10/h1-3H
InChI key:InChIKey=ILYIQZXFNCCGII-UHFFFAOYSA-N
SMILES:C(F)(=O)C=1C=CC(Cl)=NC1
Synonyms:- 3-Pyridinecarbonyl fluoride, 6-chloro-
- 6-Chloro-3-pyridinecarbonyl fluoride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
