CAS 121772-98-3
:(R)-2-Allylproline
Description:
(R)-2-Allylproline is an amino acid derivative characterized by its unique structure, which includes an allyl group attached to the proline backbone. This compound is a chiral molecule, meaning it exists in two enantiomeric forms, with the (R) configuration being one of them. It is known for its potential applications in organic synthesis and as a building block in the development of pharmaceuticals. The presence of the allyl group contributes to its reactivity, allowing for various chemical transformations. (R)-2-Allylproline is soluble in polar solvents, which facilitates its use in various chemical reactions. Additionally, its proline structure imparts certain conformational properties that can influence its biological activity. The compound's CAS number, 121772-98-3, is a unique identifier that aids in its classification and retrieval in chemical databases. Overall, (R)-2-Allylproline is of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential utility in drug development.
Formula:C8H13NO2
InChI:InChI=1S/C8H13NO2/c1-2-4-8(7(10)11)5-3-6-9-8/h2,9H,1,3-6H2,(H,10,11)/t8-/m0/s1
InChI key:InChIKey=WRBBRKMXTLLAOB-QMMMGPOBSA-N
SMILES:C(C=C)[C@@]1(C(O)=O)CCCN1
Synonyms:- 2-(2-Propen-1-yl)-L-proline
- (R)-2-Allylproline
- (R)-2-(2′-Propenyl)proline
- L-Proline, 2-(2-propenyl)-
- L-Proline, 2-(2-propen-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
